428439-25-2
Chemical Structure
Pyrrocidine B
- CAS No.: 428439-25-2
- Formula:C31H39NO4
- Molecular Weight:489.65
SMILES: C[C@]1(C[C@@H]2C)[C@](C(C)=C3)([H])[C@]([C@](C([C@](C(N4)=O)([H])C[C@@]4(C5)O)=O)([H])[C@@H]3C=C)([H])[C@@](OC6=CC=C5C=C6)([H])[C@]1([H])[C@H](C2)C
Biological Activity: Pyrrocidine B (Compound 6), an alkaloid, is a microbial secondary metabolite. Pyrrocidine B can be isolated from the endophytic fungus Neonectria ramulariae Wollenw KS-246. Pyrrocidine B has significant cytotoxicity against leukemia cells (IC50 of 4.6 μM for HL60 cells) with a weak Prolyl oligopeptidase (POP) inhibitory activity[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pyrrocidine B | Pyrrocidine B (Compound 6), an alkaloid, is a microbial secondary metabolite. Pyrrocidine B can be isolated from the endophytic fungus Neonectria ramulariae Wollenw KS-246. Pyrrocidine B has significant cytotoxicity against leukemia cells (IC50 of 4.6 μM for HL60 cells) with a weak Prolyl oligopeptidase (POP) inhibitory activity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||