477782-33-5
Chemical Structure
8-Br-NHD+
Synonym(s): Nicotinamide 8-Br-hypoxanthine dinucleotide
- CAS No.: 477782-33-5
- Formula:C21H25BrN6O15P2
- Molecular Weight:743.31
IUPAC Name: 1-((2R,3R,4S,5R)-5-((((((((2R,3S,4R,5R)-5-(8-bromo-6-oxo-1,6-dihydro-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methoxy)(hydroxy)phosphoryl)oxy)oxidophosphoryl)oxy)methyl)-3,4-dihydroxytetrahydrofuran-2-yl)-3-carbamoylpyridin-1-ium
InChIKey: RQUKJKJQKRPSRU-NAJQWHGHSA-N
SMILES: O[C@H]1[C@@H](O)[C@H](N2C(Br)=NC3=C2N=CNC3=O)O[C@@H]1COP(OP(OC[C@H]4O[C@@H]([N+]5=CC=CC(C(N)=O)=C5)[C@H](O)[C@@H]4O)([O-])=O)(O)=O
Biological Activity: 8-Br-NHD+ (Nicotinamide 8-Br-hypoxanthine dinucleotide) is a derivative of NAD+ (nicotinamide adenine dinucleotide) that acts as a potential substrate, competitive inhibitor or modulator of enzymes that interact with β-NAD+. 8-Br-NHD+ can be used to synthesize a cyclic ADP nucleotide (cADPR) analog[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
8-Br-NHD+ | 8-Br-NHD+ (Nicotinamide 8-Br-hypoxanthine dinucleotide) is a derivative of NAD+ (nicotinamide adenine dinucleotide) that acts as a potential substrate, competitive inhibitor or modulator of enzymes that interact with β-NAD+. 8-Br-NHD+ can be used to synthesize a cyclic ADP nucleotide (cADPR) analog. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||