625375-84-0
Chemical Structure
Tariquidar dimesylate
Synonym(s): XR9576 dimesylate
- CAS No.: 625375-84-0
- Formula:C40H46N4O12S2
- Molecular Weight:838.94
IUPAC Name: N-(2-((4-(2-(6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)ethyl)phenyl)carbamoyl)-4,5-dimethoxyphenyl)quinoline-3-carboxamide dimethanesulfonate
InChIKey: FBCFBFPCZHHRMA-UHFFFAOYSA-N
SMILES: O=C(NC1=CC(OC)=C(C=C1C(NC2=CC=C(C=C2)CCN3CC4=C(CC3)C=C(C(OC)=C4)OC)=O)OC)C5=CC6=CC=CC=C6N=C5.OS(=O)(C)=O.OS(=O)(C)=O
Biological Activity: Tariquidar dimesylate (XR9576 dimesylate) is a P-glycoprotein (P-gp) inhibitor. Tariquidar dimesylate increases the concentration of the drug in the brain by binding to P-glycoprotein, preventing it from transporting the drug from inside to outside the brain. Tariquidar dimesylate can be used in the study of blood-brain barrier penetration and multidrug resistance[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tariquidar dimesylate | Tariquidar dimesylate (XR9576 dimesylate) is a P-glycoprotein (P-gp) inhibitor. Tariquidar dimesylate increases the concentration of the drug in the brain by binding to P-glycoprotein, preventing it from transporting the drug from inside to outside the brain. Tariquidar dimesylate can be used in the study of blood-brain barrier penetration and multidrug resistance. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||