73488-65-0
Chemical Structure
L-Methionine-13C,d3
- CAS No.: 73488-65-0
- Formula:C413CH8D3NO2S
- Molecular Weight:153.22
InChIKey: FFEARJCKVFRZRR-ZIHWZSJBSA-N
SMILES: OC([C@@H](N)CCS[13C]([2H])([2H])[2H])=O
Biological Activity: L-Methionine-13C,d3 is the 13C- and deuterium labeled L-Methionine. L-Methionine is the L-isomer of Methionine, an essential amino acid for human development. Methionine acts as a hepatoprotectant.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
L-Methionine-13C,d3 | 99.9% | L-Methionine-13C,d3 is the 13C- and deuterium labeled L-Methionine. L-Methionine is the L-isomer of Methionine, an essential amino acid for human development. Methionine acts as a hepatoprotectant. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Methionine (Standard) | 99.95% | L-Methionine (Standard) is the analytical standard of L-Methionine. This product is intended for research and analytical applications. L-Methionine is an L-isomer of orally active Methionine, an essential amino acid. Methionine is a strong liver antidote that acts as a liver protector. L-Methionine can inhibit cell proliferation and induce cell apoptosis. L-Methionine has antitumor and antioxidant activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Methionine-13C,d5 | 98% | L-Methionine-13C,d5 is the 13C- and deuterium labeled L-Methionine. L-Methionine is the L-isomer of Methionine, an essential amino acid for human development. Methionine acts as a hepatoprotectant. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Methionine-d4 | 99.92% | L-Methionine-d4 is the deuterium labeled L-Methionine. L-Methionine is the L-isomer of Methionine, an essential amino acid for human development. Methionine acts as a hepatoprotectant. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Methionine-13C | 99.93% | L-Methionine-13C is the 13C-labeled L-Methionine. L-Methionine is the L-isomer of Methionine, an essential amino acid for human development. Methionine acts as a hepatoprotectant. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Methionine-1-13C | 98.0% | L-Methionine-1-13C is the 13C-labeled L-Methionine. L-Methionine is the L-isomer of Methionine, an essential amino acid for human development. Methionine acts as a hepatoprotectant. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Methionine-34S | 99.89% | L-Methionine-34S is a 34S-labeled L-Methionine. L-Methionine is the L-isomer of Methionine, an essential amino acid for human development. Methionine acts as a hepatoprotectant. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Methionine-d3 | 99.92% | L-Methionine-d3 is the deuterium labeled L-Methionine. L-Methionine is the L-isomer of Methionine, an essential amino acid for human development. Methionine acts as a hepatoprotectant. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Methionine-13C5,15N | 99.62% | L-Methionine-13C5,15N is the 13C- and 15N-labeled L-Methionine. L-Methionine is the L-isomer of Methionine, an essential amino acid for human development. Methionine acts as a hepatoprotectant. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Methionine-d8 | 98.0% | L-Methionine-d8 is the deuterium labeled L-Methionine. L-Methionine is the L-isomer of Methionine, an essential amino acid for human development. Methionine acts as a hepatoprotectant. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Methionine-d1 | L-Methionine-d1 is the deuterium labeled L-Methionine (HY-N0326). L-Methionine is an L-isomer of orally active Methionine, an essential amino acid. Methionine is a strong liver antidote that acts as a liver protector. L-Methionine can inhibit cell proliferation and induce cell apoptosis. L-Methionine has antitumor and antioxidant activity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Methionine-15N | 99.50% | L-Methionine-15N is the 15N-labeled L-Methionine. L-Methionine is the L-isomer of Methionine, an essential amino acid for human development. Methionine acts as a hepatoprotectant. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Methionine-15N,d8 | L-Methionine-15N,d8 is the deuterium and 15N-labeled L-Methionine. L-Methionine is the L-isomer of Methionine, an essential amino acid for human development. Methionine acts as a hepatoprotectant. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Methionine-13C5 | 99.96% | L-Methionine-13C5 is the 13C-labeled L-Methionine. L-Methionine is the L-isomer of Methionine, an essential amino acid for human development. Methionine acts as a hepatoprotectant. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Methionine | 99.84% | L-Methionine is an L-isomer of orally active Methionine, an essential amino acid. Methionine is a strong liver antidote that acts as a liver protector. L-Methionine can inhibit cell proliferation and induce cell apoptosis. L-Methionine has antitumor and antioxidant activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||