77012-31-8
Chemical Structure
Dehydropachymic acid
- CAS No.: 77012-31-8
- Formula:C33H50O5
- Molecular Weight:526.75
IUPAC Name: (R)-2-((3S,5R,10S,13R,14R,16R,17R)-3-acetoxy-16-hydroxy-4,4,10,13,14-pentamethyl-2,3,4,5,6,10,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-methyl-5-methyleneheptanoic acid
InChIKey: RWIALJIVPUCERT-DRCQUEPLSA-N
SMILES: C[C@]12[C@@]([C@]([C@H](C(O)=O)CCC(C(C)C)=C)([H])[C@H](O)C1)(CC=C3C2=CC[C@]4([H])[C@@]3(CC[C@H](OC(C)=O)C4(C)C)C)C
Biological Activity: Dehydropachymic acid is one of the major triterpenes isolated from Poria cocos. Dehydropachymic acid is more effective in autophagy-lysosome pathway (ALP) impaired cells rather than normal cells[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dehydropachymic acid | 99.95% | Dehydropachymic acid is one of the major triterpenes isolated from Poria cocos. Dehydropachymic acid is more effective in autophagy-lysosome pathway (ALP) impaired cells rather than normal cells. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dehydropachymic acid (Standard) | ≥98% | Dehydropachymic acid (Standard) is the analytical standard of Dehydropachymic acid. This product is intended for research and analytical applications. Dehydropachymic acid is one of the major triterpenes isolated from Poria cocos. Dehydropachymic acid is more effective in autophagy-lysosome pathway (ALP) impaired cells rather than normal cells. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
