77881-08-4
Chemical Structure
Schinlignan B
Synonym(s): Angeloylgomisin P
- CAS No.: 77881-08-4
- Formula:C28H34O9
- Molecular Weight:514.56
InChIKey: BKGUPIVDQHHVMV-ZQJDBEKWSA-N
SMILES: C[C@H]1CC(C=C(OCO2)C2=C3OC)=C3C4=C(OC)C(OC)=C(OC)C=C4[C@H](OC(/C(C)=C\C)=O)[C@@]1(O)C
Biological Activity: Schinlignan B (Angeloylgomisin P) is a lignan with antioxidant, anti-HIV, anti-HBV activities, which is found in plants of the Schisandra genus. Schinlignan B is promising for research of antioxidant-associated diseases[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Schinlignan B | Schinlignan B (Angeloylgomisin P) is a lignan with antioxidant, anti-HIV, anti-HBV activities, which is found in plants of the Schisandra genus. Schinlignan B is promising for research of antioxidant-associated diseases. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||