878557-55-2
Chemical Structure
WRW4
- CAS No.: 878557-55-2
- Formula:C61H65N15O6
- Molecular Weight:1104.27
IUPAC Name: (S)-N-((S)-1-(((S)-1-(((S)-1-(((S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl)amino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl)amino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl)amino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl)-2-((S)-2-amino-3-(1H-indol-3-yl)propanamido)-5-guanidinopentanamide
InChIKey: IRJDOVLLPORVJP-WOAIKHIASA-N
SMILES: O=C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CC1=CNC2=CC=CC=C12)C(N[C@@H](CC3=CNC4=CC=CC=C34)C(N[C@@H](CC5=CNC6=CC=CC=C56)C(N[C@@H](CC7=CNC8=CC=CC=C78)C(N)=O)=O)=O)=O)=O)[C@H](CC9=CNC%10=CC=CC=C9%10)N
Biological Activity: WRW4, a specific formyl peptide receptor-like 1 (FPRL1) antagonist, inhibits WKYMVm binding to FPRL1 with an IC50 of 0.23 μM. WRW4 specifically inhibits the increase in intracellular calcium by the FPRL1 agonists MMK-1, amyloid beta42 (Abeta42) peptide, and F peptide[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
WRW4 | 99.76% | WRW4, a specific formyl peptide receptor-like 1 (FPRL1) antagonist, inhibits WKYMVm binding to FPRL1 with an IC50 of 0.23 μM. WRW4 specifically inhibits the increase in intracellular calcium by the FPRL1 agonists MMK-1, amyloid beta42 (Abeta42) peptide, and F peptide. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||