886747-62-2
Chemical Structure
Phoyunbene B
- CAS No.: 886747-62-2
- Formula:C17H18O5
- Molecular Weight:302.32
IUPAC Name: (E)-4-(3-hydroxy-5-methoxystyryl)-2,3-dimethoxyphenol
InChIKey: VACLJIVMBBSOOR-SNAWJCMRSA-N
SMILES: COC1=CC(O)=CC(/C=C/C2=C(C(OC)=C(C=C2)O)OC)=C1
Biological Activity: Phoyunbene B is a similar substance to Resveratrol (HY-16561). Phoyunbene B exhibits stronger growth inhibitory activity against human liver cancer cells HepG2 compared to Resveratrol. Phoyunbene B induces G2/M phase cell cycle arrest and apoptosis. Phoyunbene B increases Bax/Bcl-2 and activates Caspase-3. Phoyunbene B inhibits the invasion and migration of cancer cells. Phoyunbene B can be used for research on liver cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Phoyunbene B | Phoyunbene B is a similar substance to Resveratrol (HY-16561). Phoyunbene B exhibits stronger growth inhibitory activity against human liver cancer cells HepG2 compared to Resveratrol. Phoyunbene B induces G2/M phase cell cycle arrest and apoptosis. Phoyunbene B increases Bax/Bcl-2 and activates Caspase-3. Phoyunbene B inhibits the invasion and migration of cancer cells. Phoyunbene B can be used for research on liver cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
