927406-46-0
Chemical Structure
5,4'-Dihydroxy-6,8-dimethoxy-7-O-rhamnosyl flavone
Synonym(s): DDR
- CAS. Nr.: 927406-46-0
- Formula:C23H24O11
- Molecular Weight:476.43
InChIKey: NRONFVSSFSHDMS-OFDUFNHSSA-N
SMILES: COC1=C2C(C(C=C(C3=CC=C(C=C3)O)O2)=O)=C(C(OC)=C1O[C@H]4[C@@H]([C@@H]([C@H]([C@@H](O4)C)O)O)O)O
Biological Activity: 5,4'-Dihydroxy-6,8-dimethoxy-7-O-rhamnosyl flavone (DDR) is an anticancer agent that can be extracted from Indigofera ovata. 5,4'-Dihydroxy-6,8-dimethoxy-7-O-rhamnosyl flavone can inhibit the PI3K/AKT and NF-кB pathways, inhibit the invasion and migration of cancer cells, and has anticancer activity[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5,4'-Dihydroxy-6,8-dimethoxy-7-O-rhamnosyl flavone | 5,4'-Dihydroxy-6,8-dimethoxy-7-O-rhamnosyl flavone (DDR) is an anticancer agent that can be extracted from Indigofera ovata. 5,4'-Dihydroxy-6,8-dimethoxy-7-O-rhamnosyl flavone can inhibit the PI3K/AKT and NF-кB pathways, inhibit the invasion and migration of cancer cells, and has anticancer activity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||