943-89-5
Chemical Structure
(E)-3-(4-Methoxyphenyl)acrylic acid
- CAS No.: 943-89-5
- Formula:C10H10O3
- Molecular Weight:178.18
SMILES: O=C(O)/C=C/C1=CC=C(OC)C=C1
Biological Activity: (E)-3-(4-Methoxyphenyl)acrylic acid (compound 3) is isolated from Arachis hypogaea, Scrophularia buergeriana Miquel, Aquilegia vulgaris, Anigozanthos preissii and so on. (E)-3-(4-Methoxyphenyl)acrylic acid shows significant hepatoprotective activity, anti-amnesic, cognition-enhancing activity, antihyperglycemic, and neuroprotective activities[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(E)-3-(4-Methoxyphenyl)acrylic acid | 99.84% | (E)-3-(4-Methoxyphenyl)acrylic acid (compound 3) is isolated from Arachis hypogaea, Scrophularia buergeriana Miquel, Aquilegia vulgaris, Anigozanthos preissii and so on. (E)-3-(4-Methoxyphenyl)acrylic acid shows significant hepatoprotective activity, anti-amnesic, cognition-enhancing activity, antihyperglycemic, and neuroprotective activities. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(E)-3-(4-Methoxyphenyl)acrylic acid (Standard) | ≥98% | (E)-3-(4-Methoxyphenyl)acrylic acid (compound 3) is isolated from Arachis hypogaea, Scrophularia buergeriana Miquel, Aquilegia vulgaris, Anigozanthos preissii and so on. (E)-3-(4-Methoxyphenyl)acrylic acid shows significant hepatoprotective activity, anti-amnesic, cognition-enhancing activity, antihyperglycemic, and neuroprotective activities. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||