109244-58-8
109244-58-8
Chemical Structure
Dihydrorhodamine 123
Synonym(s): DHR 123
- CAS No.: 109244-58-8
- Formula:C21H18N2O3
- Molecular Weight:346.38
IUPAC Name: methyl 2-(3,6-diamino-9H-xanthen-9-yl)benzoate
InChIKey: FNEZBBILNYNQGC-UHFFFAOYSA-N
SMILES: O=C(OC)C1=CC=CC=C1C2C3=C(OC4=C2C=CC(N)=C4)C=C(N)C=C3
Biological Activity: Dihydrorhodamine 123 (DHR 123) is a non-fluorescent reactive oxygen species (ROS) indicator. Dihydrorhodamine 123 is oxidized to fluorescent Rhodamine 123 (HY-D0816) within cells in the presence of reactive oxygen species and it localizes in mitochondria (Ex/Em = 515/536 nm).
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dihydrorhodamine 123 | 99.83% | Dihydrorhodamine 123 (DHR 123) is a non-fluorescent reactive oxygen species (ROS) indicator. Dihydrorhodamine 123 is oxidized to fluorescent Rhodamine 123 (HY-D0816) within cells in the presence of reactive oxygen species and it localizes in mitochondria (Ex/Em = 515/536 nm). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dihydrorhodamine 123 (Standard) | ≥98% | Dihydrorhodamine 123 (Standard) is the analytical standard of Dihydrorhodamine 123 (HY-101894). This product is intended for research and analytical applications. Dihydrorhodamine 123 (DHR 123) is a non-fluorescent reactive oxygen species (ROS) indicator. Dihydrorhodamine 123 is oxidized to fluorescent Rhodamine 123 (HY-D0816) within cells in the presence of reactive oxygen species and it localizes in mitochondria (Ex/Em = 515/536 nm). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dihydrorhodamine 123 (solution) | Dihydrorhodamine 123 (DHR 123) (solution) is a non-fluorescent reactive oxygen species (ROS) indicator. Dihydrorhodamine 123 is oxidized to fluorescent Rhodamine 123 (HY-D0816) within cells in the presence of reactive oxygen species and it localizes in mitochondria (Ex/Em = 515/536 nm). Solvent and concentration: DMSO: 10 mM |
|||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
