1140269-87-9
Chemical Structure
Caesalpinista B
- CAS No.: 1140269-87-9
- Formula:C23H32O6
- Molecular Weight:404.50
IUPAC Name: methyl (4S,4aR,5R,6aS,7R,11aS,11bS)-11b-(acetoxymethyl)-5-hydroxy-4,7-dimethyl-1,2,3,4,4a,5,6,6a,7,11,11a,11b-dodecahydrophenanthro[3,2-b]furan-4-carboxylate
InChIKey: CNRDGMAZSRXKTL-AXTFMYCFSA-N
SMILES: C(OC(C)=O)[C@@]12[C@@]3([C@]([C@@H](C)C4=C(C3)OC=C4)(C[C@@H](O)[C@]1([C@](C(OC)=O)(C)CCC2)[H])[H])[H]
Biological Activity: Caesalpinista B is a diterpenoid compound discovered in the seeds of Caesalpinia decapetala (Roth) Alston. Caesalpinista B inhibits hepatic gluconeogenesis in a dose-dependent manner and exerts its effect even at low concentrations. Caesalpinista B is used in research related to type 2 diabetes[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Caesalpinista B | Caesalpinista B is a diterpenoid compound discovered in the seeds of Caesalpinia decapetala (Roth) Alston. Caesalpinista B inhibits hepatic gluconeogenesis in a dose-dependent manner and exerts its effect even at low concentrations. Caesalpinista B is used in research related to type 2 diabetes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
