1243063-73-1
Chemical Structure
Beclin1-ATG14L interaction inhibitor 1
- CAS No.: 1243063-73-1
- Formula:C23H24N4O5S
- Molecular Weight:468.53
InChIKey: UDMANEABSHBQTD-UHFFFAOYSA-N
SMILES: O=C1N(CC2=NOC(C3CCC3)=N2)C4=CC(S(=O)(NC5=CC=CC(C)=C5C)=O)=CC=C4OC1
Biological Activity: Beclin1-ATG14L interaction inhibitor 1 (com 19) is a selective Beclin1-ATG14L interaction inhibitor. This protein interaction mechanism specifically targets complex I of the lipid kinase VPS34 without affecting complex II. Because the integrity of VPS34 complex II depends on the Beclin 1-UVRAG interaction. Beclin1-ATG14L interaction inhibitor 1 can disrupt the formation of VPS34 complex I and inhibit autophagy, but does not affect complex II-related vesicle transport[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Beclin1-ATG14L interaction inhibitor 1 | 99.92% | Beclin1-ATG14L interaction inhibitor 1 (com 19) is a selective Beclin1-ATG14L interaction inhibitor. This protein interaction mechanism specifically targets complex I of the lipid kinase VPS34 without affecting complex II. Because the integrity of VPS34 complex II depends on the Beclin 1-UVRAG interaction. Beclin1-ATG14L interaction inhibitor 1 can disrupt the formation of VPS34 complex I and inhibit autophagy, but does not affect complex II-related vesicle transport. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||