1461652-87-8
Chemical Structure
XSJ05
- CAS No.: 1461652-87-8
- Formula:C29H25N5O4S
- Molecular Weight:539.60
InChIKey: FMQOSLLXUMTNHW-QBHFQCMUSA-N
SMILES: CC1=CC=C(NC(N/N=C\C2=C3C(C(N4C3)=CC([C@](CC)(O)C(OC5)=O)=C5C4=O)=NC6=CC=CC=C26)=S)C=C1
Biological Activity: XSJ05 is a camptothecin (CPT) derivative that can inhibit topoisomerase I (Topo I) to exert anti-cancer activity. XSJ05 can trigger DNA double-strand breaks, leading to DNA damage. XSJ05 can inhibit the growth of colorectal cancer (CRC), arrest the cell cycle in G2/M phase, and induce apoptosis[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
XSJ05 | XSJ05 is a camptothecin (CPT) derivative that can inhibit topoisomerase I (Topo I) to exert anti-cancer activity. XSJ05 can trigger DNA double-strand breaks, leading to DNA damage. XSJ05 can inhibit the growth of colorectal cancer (CRC), arrest the cell cycle in G2/M phase, and induce apoptosis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||