1501943-10-7
Chemical Structure
Trigothysoid P
- CAS No.: 1501943-10-7
- Formula:C44H58O12
- Molecular Weight:778.92
InChIKey: RWZNHRBBFPIOQX-IWVAUUHTSA-N
SMILES: CC(CC(O[C@@H]([C@]1(CC[C@]([H])(C[C@]([C@]2(O)[C@@H]3[C@@H](C)[C@@]([C@@](C[C@H](C)[C@@H]4O5)([H])[C@]4(O)[C@H](O)[C@]6(C)[C@H]7O6)(O8)[C@]7([H])[C@H]2OC8(C9=CC=CC=C9)O3)(O)C)[C@@H]1C)[H])/C=C\C=C\C5=O)=O)C
Biological Activity: Trigothysoid P is a daphnane-type diterpenoid compound that can be used in antiviral and natural product chemistry research. Trigothysoid P can be extracted from the dried branches and leaves of Trigonostemon thyrsoideum (a plant of the Euphorbiaceae family, genus Trigonostemon)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Trigothysoid P | Trigothysoid P is a daphnane-type diterpenoid compound that can be used in antiviral and natural product chemistry research. Trigothysoid P can be extracted from the dried branches and leaves of Trigonostemon thyrsoideum (a plant of the Euphorbiaceae family, genus Trigonostemon). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||