17278-28-3
Chemical Structure
Isocucurbitacin B
- CAS No.: 17278-28-3
- Formula:C32H46O8
- Molecular Weight:558.70
IUPAC Name: (R,E)-6-((3S,8S,9R,10R,13R,14S,16R,17R)-3,16-dihydroxy-4,4,9,13,14-pentamethyl-2,11-dioxo-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-hydroxy-2-methyl-5-oxohept-3-en-2-yl acetate
InChIKey: WTBZNVRBNJWSPF-DZEACCAPSA-N
SMILES: C[C@]12[C@@]([C@]([C@@](C)(O)C(/C=C/C(C)(C)OC(C)=O)=O)([H])[C@H](O)C1)(CC([C@]3(C)[C@@]2([H])CC=C4[C@@]3([H])CC([C@@H](O)C4(C)C)=O)=O)C
Biological Activity:
Isocucurbitacin B is a natural terpenoid compound found in Pedicellus Melo. Isocucurbitacin B can inhibit the PI3K/AKT, MAPK, and STAT3 signaling pathways and downregulate CAV1 expression. Isocucurbitacin B can inhbit cancer cell proliferation, migration and invision. Isocucurbitacin B can induce apoptosis and cause G2/M phase arrest. Isocucurbitacin B can decrease intracellular cholesterol and PH levels and increase intracellular calcium levels. Isocucurbitacin B can be used for the research of cancer, such as glioma[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Isocucurbitacin B | 98.98% | Isocucurbitacin B is a natural terpenoid compound found in Pedicellus Melo. Isocucurbitacin B can inhibit the PI3K/AKT, MAPK, and STAT3 signaling pathways and downregulate CAV1 expression. Isocucurbitacin B can inhbit cancer cell proliferation, migration and invision. Isocucurbitacin B can induce apoptosis and cause G2/M phase arrest. Isocucurbitacin B can decrease intracellular cholesterol and PH levels and increase intracellular calcium levels. Isocucurbitacin B can be used for the research of cancer, such as glioma. |
||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||