2001062-74-2
Chemical Structure
Neocrocin B
- CAS No.: 2001062-74-2
- Formula:C48H60O22
- Molecular Weight:988.98
InChIKey: MLYOKXHGMICTEL-JQQKWWBTSA-N
SMILES: OC(C=C1/C=C/C(O[C@H]2[C@@H]([C@@H](C[C@](O)(C2)C(O)=O)O)OC(/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C(O[C@@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O)CO[C@@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO)=O)=O)=O)=C(C=C1)O
Biological Activity: Neocrocin B is a carotenoid crocin. Neocrocin B inhibits L-Glutamic acid (HY-14608)-induced neuronal cell damage in a dose-dependent manner. Neocrocin B can be used in studies related to neuronal injury[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Neocrocin B | 95.0% | Neocrocin B is a carotenoid crocin. Neocrocin B inhibits L-Glutamic acid (HY-14608)-induced neuronal cell damage in a dose-dependent manner. Neocrocin B can be used in studies related to neuronal injury. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||