2108149-00-2
Chemical Structure
Dansyl hydrazine-13C2
- CAS No.: 2108149-00-2
- Formula:C1013C2H15N3O2S
- Molecular Weight:267.32
InChIKey: KPQYDVAFRDWIBW-ZDOIIHCHSA-N
SMILES: NNS(=O)(C1=CC=CC2=C1C=CC=C2N([13CH3])[13CH3])=O
Biological Activity: Dansyl hydrazine-13C2 is the 13C-labeled Dansyl hydrazine (HY-W009411). Dansyl hydrazine is a carbohydrate-specific fluorescent dye (Ex/Em = 340 nm/525 nm). Dansyl hydrazine undergoes a condensation reaction with aldehyde groups generated by periodate oxidation on carbohydrate-containing structures to form fluorescent hydrazone compounds. Dansyl hydrazine selectively stains polysaccharides in formalin-fixed, paraffin-embedded human post-mortem brain tissues, revealing detailed structural features. Dansyl hydrazine is applicable to research related to Alzheimer's disease, Lafora disease, and polyglucosan body disease.
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dansyl hydrazine-13C2 | Dansyl hydrazine-13C2 is the 13C-labeled Dansyl hydrazine (HY-W009411). Dansyl hydrazine is a carbohydrate-specific fluorescent dye (Ex/Em = 340 nm/525 nm). Dansyl hydrazine undergoes a condensation reaction with aldehyde groups generated by periodate oxidation on carbohydrate-containing structures to form fluorescent hydrazone compounds. Dansyl hydrazine selectively stains polysaccharides in formalin-fixed, paraffin-embedded human post-mortem brain tissues, revealing detailed structural features. Dansyl hydrazine is applicable to research related to Alzheimer's disease, Lafora disease, and polyglucosan body disease. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dansyl hydrazine | 99.98% | Dansyl hydrazine is a carbohydrate-specific fluorescent dye (Ex/Em = 340 nm/525 nm). Dansyl hydrazine undergoes a condensation reaction with aldehyde groups generated by periodate oxidation on carbohydrate-containing structures to form fluorescent hydrazone compounds. Dansyl hydrazine selectively stains polysaccharides in formalin-fixed, paraffin-embedded human post-mortem brain tissues, revealing detailed structural features. Dansyl hydrazine is applicable to research related to Alzheimer's disease, Lafora disease, and polyglucosan body disease. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||