2390-63-8
Chemical Structure
Rhodamine B ethyl ester
- CAS No.: 2390-63-8
- Formula:C30H35ClN2O3
- Molecular Weight:507.06
InChIKey: UOKMUTMXUMSRKM-UHFFFAOYSA-M
SMILES: O=C(C1=C(C2=C3C=CC(N(CC)CC)=CC3=[O+]C4=C2C=CC(N(CC)CC)=C4)C=CC=C1)OCC.[Cl-]
Biological Activity: Rhodamine B ethyl ester is a hydrophilic cationic derivative of Rhodamine B (HY-Y0016), belonging to non-selective cytotoxic agents and transporters. Rhodamine B ethyl ester exhibits broad-spectrum in vitro cytotoxicity and exerts cytotoxic effects on human tumor cells. Rhodamine B ethyl ester binds effectively to lipid membranes, undergoes voltage-dependent transport across planar bilayer phosphatidylcholine membranes, and its transport can be determined by current relaxation after voltage jump. Rhodamine B ethyl ester can be used in research related to cancers such as epithelioid melanoma and colorectal adenocarcinoma[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Rhodamine B ethyl ester | Rhodamine B ethyl ester is a hydrophilic cationic derivative of Rhodamine B (HY-Y0016), belonging to non-selective cytotoxic agents and transporters. Rhodamine B ethyl ester exhibits broad-spectrum in vitro cytotoxicity and exerts cytotoxic effects on human tumor cells. Rhodamine B ethyl ester binds effectively to lipid membranes, undergoes voltage-dependent transport across planar bilayer phosphatidylcholine membranes, and its transport can be determined by current relaxation after voltage jump. Rhodamine B ethyl ester can be used in research related to cancers such as epithelioid melanoma and colorectal adenocarcinoma. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Serbian I, et al. Ester and amide derivatives of rhodamine B exert cytotoxic effects on different human tumor cell lines. Medicinal Chemistry Research, 2020, 29: 1655‑1661.
- [2]. Rokitskaya TI, et al. Effect of Alkyl Chain Length on Translocation of Rhodamine B n-Alkyl Esters across Lipid Membranes. Biophysical journal. 2018 Aug 07;115(3):514-521.
