2687960-47-8
Chemical Structure
Folic acid-13C5,15N
Synonym(s): Vitamin B9-13C5,15N; Vitamin M-13C5,15N
- CAS No.: 2687960-47-8
- Formula:C1413C5H19N615NO6
- Molecular Weight:447.35
InChIKey: OVBPIULPVIDEAO-JKYNXJBRSA-N
SMILES: O=C1C2=NC(CNC3=CC=C(C=C3)C([15NH][13C@H]([13C](O)=O)[13CH2][13CH2][13C](O)=O)=O)=CNC2=NC(N)=N1
Biological Activity: Folic acid-15N,13C5 is the 13C5 and 15N labeled Folic acid (HY-16637)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Folic acid-13C5,15N | Folic acid-15N,13C5 is the 13C5 and 15N labeled Folic acid (HY-16637). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Folic acid (Standard) | 98.39% | Folic acid (Standard) is the analytical standard of Folic acid. This product is intended for research and analytical applications. Folic acid (Vitamin B9) is a orally active essential nutrient from the B complex group of vitamins. Folic acid shows antidepressant-like effect. Folic acid sodium reduces the risk of neonatal neural tube defects. Folic acid can be used to the research of megaloblastic and macrocytic anemias due to folic deficiency. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Folic acid-d4 | Folic acid-d4 is the deuterium labeled Folic acid. Folic acid (Vitamin M; Vitamin B9) is a B vitamin; is necessary for the production and maintenance of new cells, for DNA synthesis and RNA synthesis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Folic acid-13C6 | Folic acid-13C6 is a deuterated labeled Folic acid. Folic acid (Vitamin B9) is a orally active essential nutrient from the B complex group of vitamins. Folic acid shows antidepressant-like effect. Folic acid sodium reduces the risk of neonatal neural tube defects. Folic acid can be used to the research of megaloblastic and macrocytic anemias due to folic deficiency. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Folic acid-d2 | 97.86% | Folic acid-d2 (Vitamin B9-d2) is the deuterium labeled Folic acid. Folic acid (Vitamin M; Vitamin B9) is a B vitamin; is necessary for the production and maintenance of new cells, for DNA synthesis and RNA synthesis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Folic acid-13C5 | 95.22% | Folic acid-13C5 is the 13C-labeled Folic acid. Folic acid (Vitamin M; Vitamin B9) is a B vitamin; is necessary for the production and maintenance of new cells, for DNA synthesis and RNA synthesis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(Rac)-Folic acid-13C5,15N | (Rac)-Folic acid-13C5,15N is the 13C-labeled and 15N-labeled Folic acid. Folic acid (Vitamin M; Vitamin B9) is a B vitamin; is necessary for the production and maintenance of new cells, for DNA synthesis and RNA synthesis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Folic acid | 98.55% | Folic acid (Vitamin B9) is a orally active essential nutrient from the B complex group of vitamins. Folic acid shows antidepressant-like effect. Folic acid sodium reduces the risk of neonatal neural tube defects. Folic acid can be used to the research of megaloblastic and macrocytic anemias due to folic deficiency. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||