286013-00-1
Chemical Structure
Trimethylammonium chloride-13C3
- CAS No.: 286013-00-1
- Formula:13C3H10ClN
- Molecular Weight:98.55
IUPAC Name: (2,5-dimethylphenyl)glycine
InChIKey: SZYJELPVAFJOGJ-HCULJTSZSA-N
SMILES: [13CH3]N([13CH3])[13CH3].Cl
Biological Activity: Trimethylammonium chloride-13C3 is the 13C-labeled Trimethylammonium chloride (HY-Y0504). Trimethylammonium chloride (Hegzadesil) is a non-competitive Acetylcholinesterase inhibitor. Trimethylammonium chloride reversibly blocks the deacetylation of acetylcholinesterase[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Trimethylammonium chloride-13C3 | Trimethylammonium chloride-13C3 is the 13C-labeled Trimethylammonium chloride (HY-Y0504). Trimethylammonium chloride (Hegzadesil) is a non-competitive Acetylcholinesterase inhibitor. Trimethylammonium chloride reversibly blocks the deacetylation of acetylcholinesterase. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Trimethylammonium chloride (Standard) | 99.49% | Trimethylammonium chloride (Standard) (Hegzadesil (Standard)) is the analytical standard of Trimethylammonium chloride (HY-Y0504). This product is intended for research and analytical applications. Trimethylammonium chloride (Hegzadesil) is a non-competitive Acetylcholinesterase inhibitor. Trimethylammonium chloride reversibly blocks the deacetylation of acetylcholinesterase. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Trimethylammonium chloride-d9 | 99.65% | Trimethylammonium chloride-d9 is the d9-labeled Trimethylammonium chloride (HY-Y0504). Trimethylammonium chloride (Hegzadesil) is a non-competitive Acetylcholinesterase inhibitor. Trimethylammonium chloride reversibly blocks the deacetylation of acetylcholinesterase. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Trimethylammonium chloride-d10 | Trimethylammonium chloride-d10 (Hegzadesil-d10) is the d10-labeled Trimethylammonium chloride (HY-Y0504). Trimethylammonium chloride (Hegzadesil) is a non-competitive Acetylcholinesterase inhibitor. Trimethylammonium chloride reversibly blocks the deacetylation of acetylcholinesterase. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Trimethylammonium chloride-d6 | 99.35% | Trimethylammonium chloride-d6 (Hegzadesil-d6) is the d6-labeled Trimethylammonium chloride (HY-Y0504). Trimethylammonium chloride (Hegzadesil) is a non-competitive Acetylcholinesterase inhibitor. Trimethylammonium chloride reversibly blocks the deacetylation of acetylcholinesterase. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Trimethylammonium chloride | 98.0% | Trimethylammonium chloride (Hegzadesil) is a non-competitive Acetylcholinesterase inhibitor. Trimethylammonium chloride reversibly blocks the deacetylation of acetylcholinesterase. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||