3003834-34-9
Chemical Structure
PBX-7016
- CAS No.: 3003834-34-9
- Formula:C27H25N3O8
- Molecular Weight:519.50
InChIKey: LKIONTQYHDYZJF-ZHJPETKGSA-N
SMILES: C[C@@H](O)C(N[C@@H]1C2=C3C(CC1)=C4C(OCO4)=CC3=NC5=C2CN6C5=CC7=C(COC([C@]7(O)CC)=O)C6=O)=O
Biological Activity: PBX-7016 is a Camptothecin (HY-16560) derivative. PBX-7016 can selectively inhibit Topoisomerase 1. PBX-7016 can specifically bind and degrade the cancer protein DDX5, thereby down-regulating the expression of anti-apoptotic proteins such as Survivin, Mcl-1, and XIAP, and promoting the apoptosis of cancer cells. PBX-7016 can be used to synthesis of ADCs[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PBX-7016 | PBX-7016 is a Camptothecin (HY-16560) derivative. PBX-7016 can selectively inhibit Topoisomerase 1. PBX-7016 can specifically bind and degrade the cancer protein DDX5, thereby down-regulating the expression of anti-apoptotic proteins such as Survivin, Mcl-1, and XIAP, and promoting the apoptosis of cancer cells. PBX-7016 can be used to synthesis of ADCs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
