59935-30-7
Chemical Structure
L-Isoleucine-15N
- CAS No.: 59935-30-7
- Formula:C6H1315NO2
- Molecular Weight:132.17
IUPAC Name: L-isoleucine-15N
InChIKey: AGPKZVBTJJNPAG-NNXLWEQRSA-N
SMILES: [15NH2][C@@H]([C@@H](C)CC)C(O)=O
Biological Activity: L-Isoleucine-15N is the 15N-labeled L-Isoleucine. L-isoleucine is a nonpolar hydrophobic amino acid. L-Isoleucine is an essential amino acid[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
L-Isoleucine-15N | 98.00% | L-Isoleucine-15N is the 15N-labeled L-Isoleucine. L-isoleucine is a nonpolar hydrophobic amino acid. L-Isoleucine is an essential amino acid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Isoleucine (Standard) | 97.26% | L-Isoleucine (Standard) is the analytical standard of L-Isoleucine. This product is intended for research and analytical applications. L-Isoleucine is an orally active branched chain amino acid, which is the L-enantiomer of isoleucine. L-Isoleucine has a role as a Saccharomyces cerevisiae metabolite, an Escherichia coli metabolite, a plant metabolite, a human metabolite, an algal metabolite and a mouse metabolite. L-Isoleucine regulates the inflammatory response to protect against pathogens in vivo and in vitro. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DL-Isoleucine-d10 | 98.6% | DL-Isoleucine-d10 is the deuterium labeled L-Isoleucine. L-isoleucine is a nonpolar hydrophobic amino acid. L-Isoleucine is an essential amino acid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Isoleucine-d10 | 99.89% | L-Isoleucine-d10 is the deuterium labeled L-Isoleucine. L-isoleucine is a nonpolar hydrophobic amino acid. L-Isoleucine is an essential amino acid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Isoleucine-15N,d10 | 98.0% | L-Isoleucine-15N,d10 is the deuterium and 15N-labeled L-Isoleucine. L-isoleucine is a nonpolar hydrophobic amino acid. L-Isoleucine is an essential amino acid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Isoleucine-13C6,15N | 98.0% | L-Isoleucine-13C6,15N is 13C and 15N labeled L-isoleucine. L-isoleucine is a nonpolar hydrophobic amino acid. L-Isoleucine is an essential amino acid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Isoleucine-13C6,15N,d10 | 99.9% | L-Isoleucine-13C6,15N,d10 is the deuterium, 13C-, and 15-labeled L-Isoleucine. L-isoleucine is a nonpolar hydrophobic amino acid. L-Isoleucine is an essential amino acid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Isoleucine-d | 99.48% | L-Isoleucine-d is the deuterium labeled L-Isoleucine. L-isoleucine is a nonpolar hydrophobic amino acid. L-Isoleucine is an essential amino acid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Isoleucine-1-13C | 99.99% | L-Isoleucine-1-13C is the 13C-labeled L-Isoleucine. L-isoleucine is a nonpolar hydrophobic amino acid. L-Isoleucine is an essential amino acid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Isoleucine-13C6 | 99.77% | L-Isoleucine-13C6 is the 13C-labeled L-Isoleucine. L-isoleucine is a nonpolar hydrophobic amino acid. L-Isoleucine is an essential amino acid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Isoleucine | 99.82% | L-Isoleucine is an orally active branched chain amino acid, which is the L-enantiomer of isoleucine. L-Isoleucine has a role as a Saccharomyces cerevisiae metabolite, an Escherichia coli metabolite, a plant metabolite, a human metabolite, an algal metabolite and a mouse metabolite. L-Isoleucine regulates the inflammatory response to protect against pathogens in vivo and in vitro. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||