87084-99-9
Chemical Structure
Albanol B
- CAS No.: 87084-99-9
- Formula:C34H22O8
- Molecular Weight:558.53
IUPAC Name: (R)-8a-(2,4-dihydroxyphenyl)-6-(6-hydroxybenzofuran-2-yl)-2-methyl-8aH-benzo[3,4]isochromeno[1,8-bc]chromene-4,11-diol
InChIKey: SMHBZVSVLIBGGO-UMSFTDKQSA-N
SMILES: OC1=C(C=CC(O)=C1)[C@@]23C4=C(C5=CC=C(O)C=C5O3)C=C(C)C=C4C6=C(O)C=C(C(OC7=C8)=CC7=CC=C8O)C=C6O2
Biological Activity: Albanol B is an arylbenzofuran derivative which can be isolated from mulberries. Albanol B exhibits anti-Alzheimer's disease, anti-bacterial and antioxidant activities. Albanol B inhibits cancer cells proliferation, down-regulates CDK1 expression. Albanol B also induces cell cycle arrest at G2/M and apoptosis. And Albanol B induces mitochondrial ROS production and increases the phosphorylation levels of AKT and ERK1/2[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Albanol B | 99.79% | Albanol B is an arylbenzofuran derivative which can be isolated from mulberries. Albanol B exhibits anti-Alzheimer's disease, anti-bacterial and antioxidant activities. Albanol B inhibits cancer cells proliferation, down-regulates CDK1 expression. Albanol B also induces cell cycle arrest at G2/M and apoptosis. And Albanol B induces mitochondrial ROS production and increases the phosphorylation levels of AKT and ERK1/2. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
