34532-66-6
Chemical Structure
Arnicolide B
- CAS No.: 34532-66-6
- Formula:C20H28O5
- Molecular Weight:348.44
IUPAC Name: (3S,3aR,4S,4aR,7aR,8R,9aR)-3,4a,8-trimethyl-2,5-dioxo-2,3,3a,4,4a,5,7a,8,9,9a-decahydroazuleno[6,5-b]furan-4-yl 3-methylbutanoate
InChIKey: XOSUIROVCFABAY-QUQQNCTQSA-N
SMILES: O(C(CC(C)C)=O)[C@H]1[C@]2([C@@](C[C@@H](C)[C@]3([C@@]1(C)C(=O)C=C3)[H])(OC(=O)[C@H]2C)[H])[H]
Biological Activity: Arnicolide B is a sesquiterpene lactone. Arnicolide B is isolated from Centipeda minima. Arnicolide B inhibits the phosphorylation of ERK, JNK and p38 proteins in the MAPK signaling pathway. Arnicolide B reduces the production of inflammatory mediators NO, PGE2 and IL-6. Arnicolide B downregulates the overexpression of inflammatory proteins iNOS and COX-2. Arnicolide B has no effect on IκB-α degradation or NF-κB pathway activation. Arnicolide B is applicable to inflammation-related research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Arnicolide B | Arnicolide B is a sesquiterpene lactone. Arnicolide B is isolated from Centipeda minima. Arnicolide B inhibits the phosphorylation of ERK, JNK and p38 proteins in the MAPK signaling pathway. Arnicolide B reduces the production of inflammatory mediators NO, PGE2 and IL-6. Arnicolide B downregulates the overexpression of inflammatory proteins iNOS and COX-2. Arnicolide B has no effect on IκB-α degradation or NF-κB pathway activation. Arnicolide B is applicable to inflammation-related research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
