102212-99-7
Chemical Structure
5-BrdUTP sodium salt
Synonym(s): 5-Bromo-2'-deoxyuridine 5'-triphosphate sodium salt
- CAS No.: 102212-99-7
- Formula:C9H14BrN2Na4O14P3
- Molecular Weight:639.00
SMILES: O=C(N1)N([C@@H]2O[C@H](COP(OP(OP(O)(O)=O)(O)=O)(O)=O)[C@@H](O)C2)C=C(Br)C1=O.[4Na]
Biological Activity: 5-BrdUTP sodium salt is a TdT substrate which can be used to label the DNA double-strand breaks.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5-BrdUTP sodium salt | 5-BrdUTP sodium salt is a TdT substrate which can be used to label the DNA double-strand breaks. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||