103302-15-4
Chemical Structure
D-Erythrose 4-phosphate sodium
- CAS No.: 103302-15-4
- Formula:C4H8NaO7P
- Molecular Weight:222.07
IUPAC Name: sodium (2R,3R)-2,3-dihydroxy-4-oxobutyl hydrogen phosphate
InChIKey: KKDBADMPNGAKHM-RFKZQXLXSA-M
SMILES: O=C[C@H](O)[C@H](O)COP(O)(O[Na])=O
Biological Activity: D-Erythrose 4-phosphate sodium is a phosphate sodium of the simple sugar Erythrose. Erythritol is actually converted into D-Erythrose 4-phosphate that involves three isomerases[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
D-Erythrose 4-phosphate sodium | 98% | D-Erythrose 4-phosphate sodium is a phosphate sodium of the simple sugar Erythrose. Erythritol is actually converted into D-Erythrose 4-phosphate that involves three isomerases. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||