106060-89-3
Chemical Structure
Zidovudine diphosphate
- CAS No.: 106060-89-3
- Formula:C10H15N5O10P2
- Molecular Weight:427.20
InChIKey: QOYVAFWJURKBJG-XLPZGREQSA-N
SMILES: O=C1N(C=C(C(N1)=O)C)[C@@H]2O[C@@H]([C@H](C2)N=[N+]=[N-])COP(OP(O)(O)=O)(O)=O
Biological Activity: Zidovudine diphosphate is an antiretroviral agent that exhibits the activity of inhibiting the reverse transcriptase enzyme used by HIV to synthesize DNA, thereby preventing the formation of viral DNA.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Zidovudine diphosphate | Zidovudine diphosphate is an antiretroviral agent that exhibits the activity of inhibiting the reverse transcriptase enzyme used by HIV to synthesize DNA, thereby preventing the formation of viral DNA. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||