1171122-72-7
Chemical Structure
Azido-PEG9-azide
- CAS No.: 1171122-72-7
- Formula:C20H40N6O9
- Molecular Weight:508.57
IUPAC Name: 1,29-diazido-3,6,9,12,15,18,21,24,27-nonaoxanonacosane
InChIKey: SWOJCRLGINETDK-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG9-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG9-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG9-azide | 99.97% | Azido-PEG9-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG9-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||