120484-65-3
Chemical Structure
Lymphocyte activating pentapeptide
- CAS No.: 120484-65-3
- Formula:C25H44N8O7
- Molecular Weight:568.67
InChIKey: UEAYTGFTNACKMX-VMXHOPILSA-N
SMILES: O=C(N1[C@@H](CCC1)C(N[C@@H](CO)C(N[C@H](C(O)=O)CCCNC(N)=N)=O)=O)[C@H]2N(CCC2)C([C@@H](N)CC(C)C)=O
Biological Activity: Lymphocyte activating pentapeptide is a short peptide sequence found in the Fc region of human IgG1 that has the ability to activate lymphocytes. Lymphocyte activating pentapeptide can be used to study the activation mechanisms of B cells and T cells, and their role in immune responses[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Lymphocyte activating pentapeptide | Lymphocyte activating pentapeptide is a short peptide sequence found in the Fc region of human IgG1 that has the ability to activate lymphocytes. Lymphocyte activating pentapeptide can be used to study the activation mechanisms of B cells and T cells, and their role in immune responses. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||