1219799-06-0
1219799-06-0
Chemical Structure
Propafenone-d7 hydrochloride
Synonym(s): SA-79 D7 hydrochloride
- CAS No.: 1219799-06-0
- Formula:C21H21D7ClNO3
- Molecular Weight:384.95
IUPAC Name: 1-(2-(2-hydroxy-3-((propyl-d7)amino)propoxy)phenyl)-3-phenylpropan-1-one hydrochloride
InChIKey: XWIHRGFIPXWGEF-YYEJEILISA-N
SMILES: OC(CNC([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])COC1=C(C(CCC2=CC=CC=C2)=O)C=CC=C1.[H]Cl
Biological Activity: Propafenone-d7 (hydrochloride) is the deuterium labeled Propafenone, which is a classic anti-arrhythmic agent.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Propafenone-d7 hydrochloride | Propafenone-d7 (hydrochloride) is the deuterium labeled Propafenone, which is a classic anti-arrhythmic agent. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propafenone hydrochloride (Standard) | ≥98% | Propafenone (hydrochloride) (Standard) is the analytical standard of Propafenone (hydrochloride). This product is intended for research and analytical applications. Propafenone (hydrochloride) (SA-79 (hydrochloride)) is a class of anti-arrhythmic medication, which treats illnesses associated with rapid heart beats such as atrial and ventricular arrhythmias. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propafenone-d5 Ethyl hydrochloride | Propafenone-d5 Ethyl (hydrochloride) is the deuterium labeled Propafenone hydrochloride. Propafenone (SA-79）hydrochloride is a class of anti-arrhythmic medication, which treats illnesses associated with rapid heart beats such as atrial and ventricular arrhythmias. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propafenone-d5 hydrochloride | Propafenone-d5 (hydrochloride) is the deuterium labeled Propafenone hydrochloride. Propafenone (SA-79) hydrochloride is a class of anti-arrhythmic medication, which treats illnesses associated with rapid heart beats such as atrial and ventricular arrhythmias. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propafenone-(phenyl-dd5) hydrochloride | Propafenone-(phenyl-dd5) (hydrochloride) is the deuterium labeled Propafenone hydrochloride. Propafenone hydrochloride is a class of anti-arrhythmic medication, which treats illnesses associated with rapid heart beats such as atrial and ventricular arrhythmias. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propafenone hydrochloride | 98.47% | Propafenone (hydrochloride) (SA-79 (hydrochloride)) is a class of anti-arrhythmic medication, which treats illnesses associated with rapid heart beats such as atrial and ventricular arrhythmias. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
