1219803-71-0
Chemical Structure
Piperazin-2-one-d6
- CAS No.: 1219803-71-0
- Formula:C4H2D6N2O
- Molecular Weight:106.16
IUPAC Name: piperazin-2-one-3,3,5,5,6,6-d6
InChIKey: IWELDVXSEVIIGI-NMFSSPJFSA-N
SMILES: O=C1C([2H])([2H])NC([2H])([2H])C([2H])([2H])N1
Biological Activity: Piperazin-2-one-d6 is the deuterium labeled Piperazin-2-one (HY-20128). Piperazin-2-one is a piperazine ring derivative containing amide and ester carbonyl groups. As an important intermediate, Piperazin-2-one can be used for the synthesis of various active compounds[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Piperazin-2-one-d6 | 99.3% | Piperazin-2-one-d6 is the deuterium labeled Piperazin-2-one (HY-20128). Piperazin-2-one is a piperazine ring derivative containing amide and ester carbonyl groups. As an important intermediate, Piperazin-2-one can be used for the synthesis of various active compounds. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Piperazin-2-one | 99.97% | Piperazin-2-one is a piperazine ring derivative containing amide and ester carbonyl groups. As an important intermediate, Piperazin-2-one can be used for the synthesis of various active compounds. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||