1219805-31-8
Chemical Structure
DL-Homocysteine thiolactone-d4 hydrochloride
- CAS No.: 1219805-31-8
- Formula:C4H4D4ClNOS
- Molecular Weight:157.66
IUPAC Name: 3-aminodihydrothiophen-2(3H)-one-4,4,5,5-d4 hydrochloride
InChIKey: ZSEGSUBKDDEALH-PBCJVBLFSA-N
SMILES: NC1C(SC([2H])([2H])C1([2H])[2H])=O.Cl
Biological Activity: DL-Homocysteine thiolactone-d4 hydrochloride is the deuterium labeled DL-Homocysteine thiolactone (hydrochloride). DL-Homocysteine thiolactone hydrochloride is a cyclic amino acid derivative that exhibits root-growth inhibitory activity.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DL-Homocysteine thiolactone-d4 hydrochloride | 99.83% | DL-Homocysteine thiolactone-d4 hydrochloride is the deuterium labeled DL-Homocysteine thiolactone (hydrochloride). DL-Homocysteine thiolactone hydrochloride is a cyclic amino acid derivative that exhibits root-growth inhibitory activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DL-Homocysteine thiolactone hydrochloride (Standard) | ≥98% | DL-Homocysteine thiolactone (hydrochloride) (Standard) is the analytical standard of DL-Homocysteine thiolactone (hydrochloride). This product is intended for research and analytical applications. DL-Homocysteine thiolactone hydrochloride is a cyclic amino acid derivative that exhibits root-growth inhibitory activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DL-Homocysteine thiolactone hydrochloride | 99.39% | DL-Homocysteine thiolactone hydrochloride is a cyclic amino acid derivative that exhibits root-growth inhibitory activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||