1246298-66-7
Chemical Structure
3β,7β-Dihydroxy-5-cholestenoic acid
- CAS No.: 1246298-66-7
- Formula:C27H44O4
- Molecular Weight:432.64
IUPAC Name: (2R,6R)-6-((3S,7R,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylheptanoic acid
InChIKey: GYJSAWZGYQXRBS-WMYDBBFWSA-N
SMILES: C[C@@]12[C@](CC[C@]2([H])[C@H](C)CCC[C@@H](C)C(O)=O)([H])[C@@]3([H])[C@@](CC1)([H])[C@@]4(C(C[C@H](CC4)O)=C[C@@H]3O)C
Biological Activity: 3β,7β-Dihydroxy-5-cholestenoic acid is a C27 acid that displays elevated levels in Niemann-Pick type C and Niemann-Pick type B diseases, contributing to toxicity in oculomotor neurons. It is synthesized from 3β-hydroxy-7-oxocholest-5-en-(25R)26-oic acid (3βH,7O-CA) through the enzymatic action of hydroxysteroid 11-β dehydrogenase 1.
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3β,7β-Dihydroxy-5-cholestenoic acid | 3β,7β-Dihydroxy-5-cholestenoic acid is a C27 acid that displays elevated levels in Niemann-Pick type C and Niemann-Pick type B diseases, contributing to toxicity in oculomotor neurons. It is synthesized from 3β-hydroxy-7-oxocholest-5-en-(25R)26-oic acid (3βH,7O-CA) through the enzymatic action of hydroxysteroid 11-β dehydrogenase 1. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
