1258939-39-7
Chemical Structure
NH-bis(PEG3-azide)
- CAS No.: 1258939-39-7
- Formula:C16H33N7O6
- Molecular Weight:419.48
IUPAC Name: bis(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethyl)amine
InChIKey: APYUGXCRFRUVCL-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCNCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: NH-bis(PEG3-azide) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. NH-bis(PEG3-azide) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
NH-bis(PEG3-azide) | 98.0% | NH-bis(PEG3-azide) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. NH-bis(PEG3-azide) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||