126050-26-8
Chemical Structure
Dynorphin B (1-9)
- CAS No.: 126050-26-8
- Formula:C54H78N16O12
- Molecular Weight:1143.30
InChIKey: ODVSEQVPSWYEAR-FVMQRRFMSA-N
SMILES: O=C(NCC(NCC(N[C@@H](CC1=CC=CC=C1)C(N[C@@H](CC(C)C)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCC(N)=O)C(N[C@@H](CC2=CC=CC=C2)C(O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CC3=CC=C(C=C3)O)N
Biological Activity: Dynorphin B (1-9) is a neuropeptide and N-terminal cleavage product of dynorphin B. The formation of dynorphin B (1-9) is blocked by N-ethylmaleimide (NEM), a non-selective inhibitor of cysteine peptidases[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dynorphin B (1-9) | Dynorphin B (1-9) is a neuropeptide and N-terminal cleavage product of dynorphin B. The formation of dynorphin B (1-9) is blocked by N-ethylmaleimide (NEM), a non-selective inhibitor of cysteine peptidases. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||