1263166-91-1
Chemical Structure
endo-BCN-O-PNB
- CAS No.: 1263166-91-1
- Formula:C17H17NO5
- Molecular Weight:315.32
IUPAC Name: ((1R,8S,9s)-bicyclo[6.1.0]non-4-yn-9-yl)methyl (4-nitrophenyl) carbonate
InChIKey: QXNXOXMDBLHIDB-MUJYYYPQSA-N
SMILES: O=C(OC1=CC=C([N+]([O-])=O)C=C1)OC[C@H]2[C@@]3([H])CCC#CCC[C@@]23[H]
Biological Activity: endo-BCN-O-PNB is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. endo-BCN-O-PNB is a click chemistry reagent, it contains a BCN group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
endo-BCN-O-PNB | 99.25% | endo-BCN-O-PNB is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs. endo-BCN-O-PNB is a click chemistry reagent, it contains a BCN group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||