1263721-14-7
Chemical Structure
Fmoc-L-MeLys(N3)-OH
- CAS No.: 1263721-14-7
- Formula:C22H24N4O4
- Molecular Weight:408.45
IUPAC Name: N2-(((9H-fluoren-9-yl)methoxy)carbonyl)-N6-diazo-N2-methyl-L-lysine
InChIKey: DJQVUFFDGFWHHQ-FQEVSTJZSA-N
SMILES: [N-]=[N+]=NCCCC[C@@H](C(O)=O)N(C)C(OCC1C2=CC=CC=C2C3=CC=CC=C31)=O
Biological Activity: Fmoc-L-MeLys(N3)-OH is a click chemistry reagent containing an azide. Fmoc-L-MeLys(N3)-OH is a SPPS building-block for the introduction of N-Me-Lys that can be modified at the N3-group using Click-chemistry[1]. Fmoc-L-MeLys(N3)-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Fmoc-L-MeLys(N3)-OH | Fmoc-L-MeLys(N3)-OH is a click chemistry reagent containing an azide. Fmoc-L-MeLys(N3)-OH is a SPPS building-block for the introduction of N-Me-Lys that can be modified at the N3-group using Click-chemistry. Fmoc-L-MeLys(N3)-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||