1318025-75-0
Chemical Structure
Chevalone B
- CAS No.: 1318025-75-0
- Formula:C28H40O5
- Molecular Weight:456.61
IUPAC Name: (2S,4aR,4bR,6aS,12aS,12bR,14aR)-1,1,4a,6a,9,12b-hexamethyl-11-oxo-2,3,4,4a,4b,5,6,6a,12,12a,12b,13,14,14a-tetradecahydro-1H,11H-naphtho[2,1-f]pyrano[4,3-b]chromen-2-yl acetate
InChIKey: IRSLQXSSQAASGV-GPTGPEQGSA-N
SMILES: C[C@]12[C@@](CC[C@]3([C@@]2([H])CC4=C(C=C(OC4=O)C)O3)C)([H])[C@@]5([C@@](C(C)([C@H](CC5)OC(C)=O)C)([H])CC1)C
Biological Activity: Chevalone B was isolated from the ethyl acetate extract of the marine sponge-associated fungus Aspergillus similanensis. The structure of Chevalone B was confirmed by 1D and 2D NMR spectroscopy. Chevalone B showed antimicrobial activity against Gram-positive and Gram-negative bacteria, Candida albicans, and multidrug-resistant strains from the environment. Studies on Chevalone B have shown its potential value in antimicrobial applications.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Chevalone B | Chevalone B was isolated from the ethyl acetate extract of the marine sponge-associated fungus Aspergillus similanensis. The structure of Chevalone B was confirmed by 1D and 2D NMR spectroscopy. Chevalone B showed antimicrobial activity against Gram-positive and Gram-negative bacteria, Candida albicans, and multidrug-resistant strains from the environment. Studies on Chevalone B have shown its potential value in antimicrobial applications. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
