134457-28-6
Chemical Structure
Azaline B
- CAS No.: 134457-28-6
- Formula:C80H102ClN23O12
- Molecular Weight:1613.27
InChIKey: VLGKQBGBPIVGBX-ZVSGBDDQSA-N
SMILES: NC1=NN=C(N1)NC(C=C2)=CC=C2C[C@@H](NC([C@@H](NC([C@H](CO)NC([C@H](NC([C@H](NC([C@H](NC(C)=O)CC3=CC4=C(C=CC=C4)C=C3)=O)CC5=CC=C(C=C5)Cl)=O)CC6=CN=CC=C6)=O)=O)CC7=CC=C(C=C7)NC8=NN=C(N)N8)=O)C(N[C@@H](CC(C)C)C(N[C@@H](CCCCNC(C)C)C(N9[C@@H](CCC9)C(N[C@H](C)C(N)=O)=O)=O)=O)=O
Biological Activity: Azaline B is an antagonist for gonadotropin-releasing hormone (GnRH) with IC50 of 1.37 nM, Azaline B can be used in research of sex hormone-related pathological states, ovulation induction and male contraception[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azaline B | Azaline B is an antagonist for gonadotropin-releasing hormone (GnRH) with IC50 of 1.37 nM, Azaline B can be used in research of sex hormone-related pathological states, ovulation induction and male contraception. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||