136098-07-2
Chemical Structure
Heparin disaccharide IV-A sodium
- CAS No.: 136098-07-2
- Formula:C14H20NNaO11
- Molecular Weight:401.30
IUPAC Name: (2R,3R,4S)-2-(((2R,3S,4R,5R)-5-acetamido-1,2,4-trihydroxy-6-oxohexan-3-yl)oxy)-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid, sodium salt
InChIKey: ITWXNNTXSXNPNW-WYBHFVFNSA-M
SMILES: O=C(O[Na])C(O[C@H]1O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)NC(C)=O)=C[C@@H]([C@H]1O)O
Biological Activity: Heparin disaccharide IV-A sodium is an immune-modulatory heparin disaccharide sodium salt that can be attached to biodegradable polymeric particles to form carbohydrate-enhanced nanoparticles (CENPs)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Heparin disaccharide IV-A sodium | Heparin disaccharide IV-A sodium is an immune-modulatory heparin disaccharide sodium salt that can be attached to biodegradable polymeric particles to form carbohydrate-enhanced nanoparticles (CENPs). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||