137354-65-5
Chemical Structure
Mastoparan B
- CAS No.: 137354-65-5
- Formula:C78H138N20O16
- Molecular Weight:1612.05
InChIKey: NSFBOCKFBVQQKB-CQWNSWRRSA-N
SMILES: CC(C)C[C@H](N)C(N[C@@H](CCCCN)C(N[C@@H](CC(C)C)C(N[C@@H](CCCCN)C(N[C@@H](CO)C(N[C@@H]([C@@H](C)CC)C(N[C@@H](C(C)C)C(N[C@@H](CO)C(N[C@H](C(N[C@@H](C)C(N[C@@H](CCCCN)C(N[C@@H](CCCCN)C(N[C@@H](C(C)C)C(N[C@H](C(N)=O)CC(C)C)=O)=O)=O)=O)=O)CC1=CNC2=CC=CC=C12)=O)=O)=O)=O)=O)=O)=O)=O
Biological Activity: Mastoparan B is an antimicrobial peptide derived from hornet Vespa. Mastoparan B can cause the shape of red blood cells to change from normal disk-like to serrated[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Mastoparan B | Mastoparan B is an antimicrobial peptide derived from hornet Vespa. Mastoparan B can cause the shape of red blood cells to change from normal disk-like to serrated. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||