1402411-88-4
Chemical Structure
Azido-PEG5-succinimidyl carbonate
- CAS No.: 1402411-88-4
- Formula:C17H28N4O10
- Molecular Weight:448.43
IUPAC Name: 17-azido-3,6,9,12,15-pentaoxaheptadecyl (2,5-dioxopyrrolidin-1-yl) carbonate
InChIKey: RDPYDXXYIRLZAG-UHFFFAOYSA-N
SMILES: O=C(ON1C(CCC1=O)=O)OCCOCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG5-succinimidyl carbonate is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG5-succinimidyl carbonate is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG5-succinimidyl carbonate | Azido-PEG5-succinimidyl carbonate is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG5-succinimidyl carbonate is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
