1421708-43-1
Chemical Structure
Neosartoricin B
- CAS No.: 1421708-43-1
- Formula:C24H26O8
- Molecular Weight:442.46
IUPAC Name: (2S,3R)-2,3,6,8,9-pentahydroxy-3-((Z)-4-hydroxy-2-oxopent-3-en-1-yl)-10-(3-methylbut-2-en-1-yl)-3,4-dihydroanthracen-1(2H)-one
InChIKey: FBJVDZCVXPNUAZ-DVKPJADZSA-N
SMILES: OC1=C2C(C[C@](O)([C@@H](C2=O)O)CC(/C=C(O)/C)=O)=C(C3=CC(O)=CC(O)=C31)C/C=C(C)\C
Biological Activity: Neosartoricin B is the secondary metabolite, which can be produced by Aspergillus nidulans. Neosartoricin B may regulate immunomodulatory effects with the host during infection and colonization by pathogenic fungi[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Neosartoricin B | 90.50% | Neosartoricin B is the secondary metabolite, which can be produced by Aspergillus nidulans. Neosartoricin B may regulate immunomodulatory effects with the host during infection and colonization by pathogenic fungi. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||