145701-23-1
Chemical Structure
Florasulam
- CAS No.: 145701-23-1
- Formula:C12H8F3N5O3S
- Molecular Weight:359.28
IUPAC Name: N-(2,6-difluorophenyl)-8-fluoro-5-methoxy-[1,2,4]triazolo[1,5-c]pyrimidine-2-sulfonamide
InChIKey: QZXATCCPQKOEIH-UHFFFAOYSA-N
SMILES: O=S(NC1=C(F)C=CC=C1F)(C2=NN3C(OC)=NC=C(F)C3=N2)=O
Biological Activity: Florasulam is a targeted post-emergent herbicide belonging to the triazolopyrimidine sulfonanilide class, which functions by inhibiting acetolactate synthase (ALS) in plants. Located in the chloroplasts, ALS plays a crucial role in the biosynthesis of branched-chain amino acids. When Florasulam inhibits ALS, it disrupts plant cell division, reduces growth, and ultimately leads to plant death.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Florasulam | 99.42% | Florasulam is a targeted post-emergent herbicide belonging to the triazolopyrimidine sulfonanilide class, which functions by inhibiting acetolactate synthase (ALS) in plants. Located in the chloroplasts, ALS plays a crucial role in the biosynthesis of branched-chain amino acids. When Florasulam inhibits ALS, it disrupts plant cell division, reduces growth, and ultimately leads to plant death. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Florasulam (Standard) | ≥98% | Florasulam (Standard) is the analytical standard of Florasulam. This product is intended for research and analytical applications. Florasulam is a targeted post-emergent herbicide belonging to the triazolopyrimidine sulfonanilide class, which functions by inhibiting acetolactate synthase (ALS) in plants. Located in the chloroplasts, ALS plays a crucial role in the biosynthesis of branched-chain amino acids. When Florasulam inhibits ALS, it disrupts plant cell division, reduces growth, and ultimately leads to plant death. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Florasulam-13C,d3 | Florasulam-13C,d3 is the 13C- and deuterium labeled Florasulam. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
