1493802-95-1
Chemical Structure
endo-BCN-Fmoc-L-Lysine
- CAS No.: 1493802-95-1
- Formula:C32H36N2O6
- Molecular Weight:544.64
IUPAC Name: N2-(((9H-fluoren-9-yl)methoxy)carbonyl)-N6-((((1R,8S,9s)-bicyclo[6.1.0]non-4-yn-9-yl)methoxy)carbonyl)-L-lysine
InChIKey: SIGNVLQONFQEFM-UMNYJUJISA-N
SMILES: C(OC(N[C@@H](CCCCNC(OC[C@@H]1[C@]2([C@@]1(CCC#CCC2)[H])[H])=O)C(O)=O)=O)C3C=4C(C=5C3=CC=CC5)=CC=CC4
Biological Activity: Endo-BCN-Fmoc-L-Lysine is a linker containing the lyophilic bidentate macrocyclic ligand endo-BCN, which can further synthesize macrocyclic complexes. In click chemistry, endo-BCN can react with molecules containing azide groups to form stable triazoles in the absence of catalysts.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
endo-BCN-Fmoc-L-Lysine | Endo-BCN-Fmoc-L-Lysine is a linker containing the lyophilic bidentate macrocyclic ligand endo-BCN, which can further synthesize macrocyclic complexes. In click chemistry, endo-BCN can react with molecules containing azide groups to form stable triazoles in the absence of catalysts. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||