153252-36-9
Chemical Structure
β-D-tetraacetylgalactopyranoside-PEG1-N3
- CAS No.: 153252-36-9
- Formula:C18H27N3O11
- Molecular Weight:461.42
IUPAC Name: (2R,3S,4S,5R,6R)-2-(acetoxymethyl)-6-(2-(2-azidoethoxy)ethoxy)tetrahydro-2H-pyran-3,4,5-triyl triacetate
InChIKey: OFRJNIAQTXDUKV-DISONHOPSA-N
SMILES: CC(O[C@H]([C@H]([C@@H]1OCCOCCN=[N+]=[N-])OC(C)=O)[C@H]([C@H](O1)COC(C)=O)OC(C)=O)=O
Biological Activity: β-D-tetraacetylgalactopyranoside-PEG1-N3 is a cleavable 1 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. β-D-tetraacetylgalactopyranoside-PEG1-N3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
β-D-tetraacetylgalactopyranoside-PEG1-N3 | 98.0% | β-D-tetraacetylgalactopyranoside-PEG1-N3 is a cleavable 1 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). β-D-tetraacetylgalactopyranoside-PEG1-N3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
