157676-96-5
Chemical Structure
Aspinonene
- CAS No.: 157676-96-5
- Formula:C9H16O4
- Molecular Weight:188.22
IUPAC Name: (2R,5S,E)-2-((2R,3S)-3-methyloxiran-2-yl)hex-3-ene-1,2,5-triol
InChIKey: ZXCYAEKEHIEQHD-SVQZIREZSA-N
SMILES: C[C@H](O)/C=C/[C@](O)([C@@]1([H])[C@@H](O1)C)CO
Biological Activity: Aspinonene is a bioactive compound that has the function of regulating plant growth and defense mechanisms. It can participate in biochemical signaling pathways in plants and affect various physiological responses such as growth, defense and adaptation to environmental stress.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Aspinonene | Aspinonene is a bioactive compound that has the function of regulating plant growth and defense mechanisms. It can participate in biochemical signaling pathways in plants and affect various physiological responses such as growth, defense and adaptation to environmental stress. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||