1632372-86-1
Chemical Structure
Azido-PEG4-alpha-D-mannose
- CAS No.: 1632372-86-1
- Formula:C14H27N3O9
- Molecular Weight:381.38
IUPAC Name: (2S,3S,4S,5S,6R)-2-(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethoxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol
InChIKey: AJCOHNWPGBTGTQ-DGTMBMJNSA-N
SMILES: O[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)[C@H]1OCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG4-alpha-D-mannose is a PEG linker that combines an azide group with an alpha-D-mannose moiety. Azido-PEG4-alpha-D-mannose is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. Azido-PEG4-alpha-D-mannose has the targeting property of mannose, which can accurately deliver drugs to specific cells or tissues to improve the therapeutic effect of drugs[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG4-alpha-D-mannose | 99.80% | Azido-PEG4-alpha-D-mannose is a PEG linker that combines an azide group with an alpha-D-mannose moiety. Azido-PEG4-alpha-D-mannose is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. Azido-PEG4-alpha-D-mannose has the targeting property of mannose, which can accurately deliver drugs to specific cells or tissues to improve the therapeutic effect of drugs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||