1638973-78-0
Chemical Structure
MitoEbselen-2 chloride
Synonym(s): MitoPeroxidase 2
- CAS No.: 1638973-78-0
- Formula:C35H30ClN2O2PSe
- Molecular Weight:656.01
IUPAC Name: (2-(2-(4-(3-oxobenzo[d][1,2]selenazol-2(3H)-yl)phenyl)acetamido)ethyl)triphenylphosphonium chloride
InChIKey: RWZPPTYDYPSPOY-UHFFFAOYSA-N
SMILES: O=C(NCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)CC4=CC=C(N5[Se]C6=C(C=CC=C6)C5=O)C=C4.[Cl-]
Biological Activity: MitoEbselen-2 chloride (MitoPeroxidase 2), a mitochondria-targeted mimic of glutathione peroxidase, is a radiation mitigator. MitoEbselen-2 chloride is effective in reducing lipid hydroperoxides, preventing apoptotic cell death[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
MitoEbselen-2 chloride | 95.0% | MitoEbselen-2 chloride (MitoPeroxidase 2), a mitochondria-targeted mimic of glutathione peroxidase, is a radiation mitigator. MitoEbselen-2 chloride is effective in reducing lipid hydroperoxides, preventing apoptotic cell death. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||